C21H17F6O3S2+ — CID 22373929
1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;triphenylsulfanium (PubChem CID 22373929) has the molecular formula C21H17F6O3S2+ and a molecular weight of 495.49 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;triphenylsulfanium.
| Compound Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 22373929 |
| Molecular Formula | C21H17F6O3S2+ |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;triphenylsulfanium |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3H2F6O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-1(5)2(6,7)3(8,9)13(10,11)12/h1-15H;1H,(H,10,11,12)/q+1; |
| InChIKey | UVBHITFDOQNDRU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|