About N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide
N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide (PubChem CID 22373951) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide.
Molecular Properties
| Compound Name | N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide |
| PubChem CID | 22373951 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide |
| SMILES | CC1(C)CCC(=O)c2cc(NC=O)ccc21 |
| InChI | InChI=1S/C13H15NO2/c1-13(2)6-5-12(16)10-7-9(14-8-15)3-4-11(10)13/h3-4,7-8H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | FZYVEOOJGMHMCY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide?
The IUPAC name of N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide (CID 22373951) is N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide.
What is the SMILES notation for N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide?
The canonical SMILES for N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide is CC1(C)CCC(=O)c2cc(NC=O)ccc21.
What is the InChIKey of N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide?
The InChIKey is FZYVEOOJGMHMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-13(2)6-5-12(16)10-7-9(14-8-15)3-4-11(10)13/h3-4,7-8H,5-6H2,1-2H3,(H,14,15).
What are the key properties of N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide?
N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide has a molecular weight of 217.27 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)formamide is sourced from PubChem (CID 22373951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).