About 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate
1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 22373982) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate.
Molecular Properties
| Compound Name | 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate |
| PubChem CID | 22373982 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | C=CC[n+]1cn(C)nc1[S-] |
| InChI | InChI=1S/C6H9N3S/c1-3-4-9-5-8(2)7-6(9)10/h3,5H,1,4H2,2H3 |
| InChIKey | KUZIBHUDQUVBBV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate?
The IUPAC name of 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate (CID 22373982) is 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate.
What is the SMILES notation for 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate?
The canonical SMILES for 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate is C=CC[n+]1cn(C)nc1[S-].
What is the InChIKey of 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate?
The InChIKey is KUZIBHUDQUVBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c1-3-4-9-5-8(2)7-6(9)10/h3,5H,1,4H2,2H3.
What are the key properties of 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate?
1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate has a molecular weight of 155.23 g/mol, XLogP of -0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate is sourced from PubChem (CID 22373982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).