About thian-4-yl hexanoate
thian-4-yl hexanoate (PubChem CID 22374053) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is thian-4-yl hexanoate.
Molecular Properties
| Compound Name | thian-4-yl hexanoate |
| PubChem CID | 22374053 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | thian-4-yl hexanoate |
| SMILES | CCCCCC(=O)OC1CCSCC1 |
| InChI | InChI=1S/C11H20O2S/c1-2-3-4-5-11(12)13-10-6-8-14-9-7-10/h10H,2-9H2,1H3 |
| InChIKey | PTONOGONYMIZTM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze thian-4-yl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thian-4-yl hexanoate?
The IUPAC name of thian-4-yl hexanoate (CID 22374053) is thian-4-yl hexanoate.
What is the SMILES notation for thian-4-yl hexanoate?
The canonical SMILES for thian-4-yl hexanoate is CCCCCC(=O)OC1CCSCC1.
What is the InChIKey of thian-4-yl hexanoate?
The InChIKey is PTONOGONYMIZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-2-3-4-5-11(12)13-10-6-8-14-9-7-10/h10H,2-9H2,1H3.
What are the key properties of thian-4-yl hexanoate?
thian-4-yl hexanoate has a molecular weight of 216.35 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thian-4-yl hexanoate is sourced from PubChem (CID 22374053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).