2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid

C9H10N4O4 — CID 22375

IUPAC2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid
SMILESCn1cnc2c1c(=O)n(CC(=O)O)c(=O)n2C
InChIInChI=1S/C9H10N4O4/c1-11-4-10-7-6(11)8(16)13(3-5(14)15)9(17)12(7)2/h4H,3H2,1-2H3,(H,14,15)
InChIKeyYCTSCXLOPJCPDH-UHFFFAOYSA-N
MW238.20 g/mol
LogP-1.48
Rot. Bonds2

About 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid

2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid (PubChem CID 22375) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid
PubChem CID22375
Molecular FormulaC9H10N4O4
Molecular Weight238.20 g/mol
Exact Mass238.07
IUPAC Name2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid
SMILESCn1cnc2c1c(=O)n(CC(=O)O)c(=O)n2C
InChIInChI=1S/C9H10N4O4/c1-11-4-10-7-6(11)8(16)13(3-5(14)15)9(17)12(7)2/h4H,3H2,1-2H3,(H,14,15)
InChIKeyYCTSCXLOPJCPDH-UHFFFAOYSA-N
XLogP-1.48
TPSA99.12 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.20
LogP ≤ 5-1.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid?
The IUPAC name of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid (CID 22375) is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid.
What is the SMILES notation for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid?
The canonical SMILES for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid is Cn1cnc2c1c(=O)n(CC(=O)O)c(=O)n2C.
What is the InChIKey of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid?
The InChIKey is YCTSCXLOPJCPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4/c1-11-4-10-7-6(11)8(16)13(3-5(14)15)9(17)12(7)2/h4H,3H2,1-2H3,(H,14,15).
What are the key properties of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid?
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid has a molecular weight of 238.20 g/mol, XLogP of -1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid is sourced from PubChem (CID 22375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).