C18H24N2O3 — CID 22375405
1-[4-(6-methoxy-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]butane-1,2-dione (PubChem CID 22375405) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[4-(6-methoxy-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]butane-1,2-dione.
| Compound Name | 1-[4-(6-methoxy-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]butane-1,2-dione |
|---|---|
| PubChem CID | 22375405 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[4-(6-methoxy-2,3-dihydro-1H-inden-1-yl)piperazin-1-yl]butane-1,2-dione |
| SMILES | CCC(=O)C(=O)N1CCN(C2CCc3ccc(OC)cc32)CC1 |
| InChI | InChI=1S/C18H24N2O3/c1-3-17(21)18(22)20-10-8-19(9-11-20)16-7-5-13-4-6-14(23-2)12-15(13)16/h4,6,12,16H,3,5,7-11H2,1-2H3 |
| InChIKey | GYLJYZOMBRPCHA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|