About 1,1-diamino-1,6-diphenylhexan-3-ol
1,1-diamino-1,6-diphenylhexan-3-ol (PubChem CID 22376004) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,1-diamino-1,6-diphenylhexan-3-ol.
Molecular Properties
| Compound Name | 1,1-diamino-1,6-diphenylhexan-3-ol |
| PubChem CID | 22376004 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1,1-diamino-1,6-diphenylhexan-3-ol |
| SMILES | NC(N)(CC(O)CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O/c19-18(20,16-11-5-2-6-12-16)14-17(21)13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12,17,21H,7,10,13-14,19-20H2 |
| InChIKey | RXNVPGSQFHIZIB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diamino-1,6-diphenylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diamino-1,6-diphenylhexan-3-ol?
The IUPAC name of 1,1-diamino-1,6-diphenylhexan-3-ol (CID 22376004) is 1,1-diamino-1,6-diphenylhexan-3-ol.
What is the SMILES notation for 1,1-diamino-1,6-diphenylhexan-3-ol?
The canonical SMILES for 1,1-diamino-1,6-diphenylhexan-3-ol is NC(N)(CC(O)CCCc1ccccc1)c1ccccc1.
What is the InChIKey of 1,1-diamino-1,6-diphenylhexan-3-ol?
The InChIKey is RXNVPGSQFHIZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O/c19-18(20,16-11-5-2-6-12-16)14-17(21)13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12,17,21H,7,10,13-14,19-20H2.
What are the key properties of 1,1-diamino-1,6-diphenylhexan-3-ol?
1,1-diamino-1,6-diphenylhexan-3-ol has a molecular weight of 284.40 g/mol, XLogP of 2.53, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diamino-1,6-diphenylhexan-3-ol is sourced from PubChem (CID 22376004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).