About 2-propylheptanenitrile
2-propylheptanenitrile (PubChem CID 22376131) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-propylheptanenitrile.
Molecular Properties
| Compound Name | 2-propylheptanenitrile |
| PubChem CID | 22376131 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2-propylheptanenitrile |
| SMILES | CCCCCC(C#N)CCC |
| InChI | InChI=1S/C10H19N/c1-3-5-6-8-10(9-11)7-4-2/h10H,3-8H2,1-2H3 |
| InChIKey | NJABNUVNVZSEGN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propylheptanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylheptanenitrile?
The IUPAC name of 2-propylheptanenitrile (CID 22376131) is 2-propylheptanenitrile.
What is the SMILES notation for 2-propylheptanenitrile?
The canonical SMILES for 2-propylheptanenitrile is CCCCCC(C#N)CCC.
What is the InChIKey of 2-propylheptanenitrile?
The InChIKey is NJABNUVNVZSEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-3-5-6-8-10(9-11)7-4-2/h10H,3-8H2,1-2H3.
What are the key properties of 2-propylheptanenitrile?
2-propylheptanenitrile has a molecular weight of 153.27 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylheptanenitrile is sourced from PubChem (CID 22376131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).