C19H30F4O3Si — CID 22377051
triethoxy-(2,3,4,5-tetrafluoro-6-heptylphenyl)silane (PubChem CID 22377051) has the molecular formula C19H30F4O3Si and a molecular weight of 410.52 g/mol. Its IUPAC name is triethoxy-(2,3,4,5-tetrafluoro-6-heptylphenyl)silane.
| Compound Name | triethoxy-(2,3,4,5-tetrafluoro-6-heptylphenyl)silane |
|---|---|
| PubChem CID | 22377051 |
| Molecular Formula | C19H30F4O3Si |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | triethoxy-(2,3,4,5-tetrafluoro-6-heptylphenyl)silane |
| SMILES | CCCCCCCc1c(F)c(F)c(F)c(F)c1[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C19H30F4O3Si/c1-5-9-10-11-12-13-14-15(20)16(21)17(22)18(23)19(14)27(24-6-2,25-7-3)26-8-4/h5-13H2,1-4H3 |
| InChIKey | OKVVLSLXIDBVOL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|