C19H24N4O6S2 — CID 22378242
N-carbamimidoyl-N-[4-[2-(dimethylamino)ethylsulfonyl]phenoxy]-3-methylsulfonylbenzamide (PubChem CID 22378242) has the molecular formula C19H24N4O6S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-carbamimidoyl-N-[4-[2-(dimethylamino)ethylsulfonyl]phenoxy]-3-methylsulfonylbenzamide.
| Compound Name | N-carbamimidoyl-N-[4-[2-(dimethylamino)ethylsulfonyl]phenoxy]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22378242 |
| Molecular Formula | C19H24N4O6S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-carbamimidoyl-N-[4-[2-(dimethylamino)ethylsulfonyl]phenoxy]-3-methylsulfonylbenzamide |
| SMILES | [H]/N=C(\N)N(Oc1ccc(S(=O)(=O)CCN(C)C)cc1)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H24N4O6S2/c1-22(2)11-12-31(27,28)16-9-7-15(8-10-16)29-23(19(20)21)18(24)14-5-4-6-17(13-14)30(3,25)26/h4-10,13H,11-12H2,1-3H3,(H3,20,21) |
| InChIKey | RWHBSAUEXWXBOU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|