C16H14ClF6N5O2 — CID 2237865
N-(4-chlorophenyl)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 2237865) has the molecular formula C16H14ClF6N5O2 and a molecular weight of 457.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-chlorophenyl)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2237865 |
| Molecular Formula | C16H14ClF6N5O2 |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)C(Oc1nc(Nc2ccc(Cl)cc2)nc(N2CCOCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C16H14ClF6N5O2/c17-9-1-3-10(4-2-9)24-12-25-13(28-5-7-29-8-6-28)27-14(26-12)30-11(15(18,19)20)16(21,22)23/h1-4,11H,5-8H2,(H,24,25,26,27) |
| InChIKey | KWKQZVKXESIMLS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |