C26H21N7O4 — CID 22379541
1-[6-[4-(1-pyridin-3-ylpyrazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 22379541) has the molecular formula C26H21N7O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is 1-[6-[4-(1-pyridin-3-ylpyrazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[4-(1-pyridin-3-ylpyrazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 22379541 |
| Molecular Formula | C26H21N7O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-[6-[4-(1-pyridin-3-ylpyrazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCN2c2ccc(Oc3ccc(-c4ccn(-c5cccnc5)n4)cc3)nc2)C(=O)N1 |
| InChI | InChI=1S/C26H21N7O4/c34-23-26(24(35)30-25(36)29-23)11-2-13-32(26)18-6-9-22(28-16-18)37-20-7-4-17(5-8-20)21-10-14-33(31-21)19-3-1-12-27-15-19/h1,3-10,12,14-16H,2,11,13H2,(H2,29,30,34,35,36) |
| InChIKey | YDDNGXZSGODIOC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|