C26H19FN6O5 — CID 22379565
1-[6-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 22379565) has the molecular formula C26H19FN6O5 and a molecular weight of 514.47 g/mol. Its IUPAC name is 1-[6-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 22379565 |
| Molecular Formula | C26H19FN6O5 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[6-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCN2c2ccc(Oc3ccc(-c4noc(-c5ccc(F)cc5)n4)cc3)nc2)C(=O)N1 |
| InChI | InChI=1S/C26H19FN6O5/c27-17-6-2-16(3-7-17)22-29-21(32-38-22)15-4-9-19(10-5-15)37-20-11-8-18(14-28-20)33-13-1-12-26(33)23(34)30-25(36)31-24(26)35/h2-11,14H,1,12-13H2,(H2,30,31,34,35,36) |
| InChIKey | FXZAGMLZMXKDQX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|