C26H20N6O5 — CID 22379601
1-[6-[4-(5-pyridin-4-yl-1,2-oxazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 22379601) has the molecular formula C26H20N6O5 and a molecular weight of 496.48 g/mol. Its IUPAC name is 1-[6-[4-(5-pyridin-4-yl-1,2-oxazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[4-(5-pyridin-4-yl-1,2-oxazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 22379601 |
| Molecular Formula | C26H20N6O5 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[6-[4-(5-pyridin-4-yl-1,2-oxazol-3-yl)phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCN2c2ccc(Oc3ccc(-c4cc(-c5ccncc5)on4)cc3)nc2)C(=O)N1 |
| InChI | InChI=1S/C26H20N6O5/c33-23-26(24(34)30-25(35)29-23)10-1-13-32(26)18-4-7-22(28-15-18)36-19-5-2-16(3-6-19)20-14-21(37-31-20)17-8-11-27-12-9-17/h2-9,11-12,14-15H,1,10,13H2,(H2,29,30,33,34,35) |
| InChIKey | WHQQKTQSOUXYPT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|