C28H23N5O5 — CID 22379607
1-[6-[4-[5-(4-methylphenyl)-1,2-oxazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 22379607) has the molecular formula C28H23N5O5 and a molecular weight of 509.52 g/mol. Its IUPAC name is 1-[6-[4-[5-(4-methylphenyl)-1,2-oxazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[4-[5-(4-methylphenyl)-1,2-oxazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 22379607 |
| Molecular Formula | C28H23N5O5 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 1-[6-[4-[5-(4-methylphenyl)-1,2-oxazol-3-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cc1ccc(-c2cc(-c3ccc(Oc4ccc(N5CCCC56C(=O)NC(=O)NC6=O)cn4)cc3)no2)cc1 |
| InChI | InChI=1S/C28H23N5O5/c1-17-3-5-19(6-4-17)23-15-22(32-38-23)18-7-10-21(11-8-18)37-24-12-9-20(16-29-24)33-14-2-13-28(33)25(34)30-27(36)31-26(28)35/h3-12,15-16H,2,13-14H2,1H3,(H2,30,31,34,35,36) |
| InChIKey | ABTDENFJKZBNNJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|