C28H22FN5O5 — CID 22379645
7-[6-[4-[4-(4-fluorophenyl)-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-2,4,7-triazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 22379645) has the molecular formula C28H22FN5O5 and a molecular weight of 527.51 g/mol. Its IUPAC name is 7-[6-[4-[4-(4-fluorophenyl)-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-2,4,7-triazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 7-[6-[4-[4-(4-fluorophenyl)-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-2,4,7-triazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 22379645 |
| Molecular Formula | C28H22FN5O5 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 7-[6-[4-[4-(4-fluorophenyl)-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-2,4,7-triazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | O=C1NC(=O)C2(CCCCN2c2ccc(Oc3ccc(-c4nc(-c5ccc(F)cc5)co4)cc3)nc2)C(=O)N1 |
| InChI | InChI=1S/C28H22FN5O5/c29-19-7-3-17(4-8-19)22-16-38-24(31-22)18-5-10-21(11-6-18)39-23-12-9-20(15-30-23)34-14-2-1-13-28(34)25(35)32-27(37)33-26(28)36/h3-12,15-16H,1-2,13-14H2,(H2,32,33,35,36,37) |
| InChIKey | QSGPPCMFCVKVFN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|