C28H25N5O6 — CID 22379698
1-[6-[4-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 22379698) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-[6-[4-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[4-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 22379698 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-[6-[4-[4-(4-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | COc1ccc(C2COC(c3ccc(Oc4ccc(N5CCCC56C(=O)NC(=O)NC6=O)cn4)cc3)=N2)cc1 |
| InChI | InChI=1S/C28H25N5O6/c1-37-20-8-3-17(4-9-20)22-16-38-24(30-22)18-5-10-21(11-6-18)39-23-12-7-19(15-29-23)33-14-2-13-28(33)25(34)31-27(36)32-26(28)35/h3-12,15,22H,2,13-14,16H2,1H3,(H2,31,32,34,35,36) |
| InChIKey | JVSZQMYCSQOMAY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|