About 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole
4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 2238014) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 2238014 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1cccc(C)c1OCCCCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C17H24N2O/c1-12-8-7-9-13(2)17(12)20-11-6-5-10-16-14(3)18-19-15(16)4/h7-9H,5-6,10-11H2,1-4H3,(H,18,19) |
| InChIKey | JEYXIJNAQRWGGT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole (CID 2238014) is 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole is Cc1cccc(C)c1OCCCCc1c(C)n[nH]c1C.
What is the InChIKey of 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is JEYXIJNAQRWGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-12-8-7-9-13(2)17(12)20-11-6-5-10-16-14(3)18-19-15(16)4/h7-9H,5-6,10-11H2,1-4H3,(H,18,19).
What are the key properties of 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 272.39 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,6-dimethylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 2238014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).