About 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol
4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 22380404) has the molecular formula C16H18F2N4O2
and a molecular weight of 336.34 g/mol. Its IUPAC name is 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol |
| PubChem CID | 22380404 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | Nc1ncc(Oc2ccc(F)cc2F)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C16H18F2N4O2/c17-9-1-6-13(12(18)7-9)24-14-8-20-16(19)22-15(14)21-10-2-4-11(23)5-3-10/h1,6-8,10-11,23H,2-5H2,(H3,19,20,21,22) |
| InChIKey | MLOBJYUFYMHJIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol?
The IUPAC name of 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol (CID 22380404) is 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol?
The canonical SMILES for 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol is Nc1ncc(Oc2ccc(F)cc2F)c(NC2CCC(O)CC2)n1.
What is the InChIKey of 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol?
The InChIKey is MLOBJYUFYMHJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N4O2/c17-9-1-6-13(12(18)7-9)24-14-8-20-16(19)22-15(14)21-10-2-4-11(23)5-3-10/h1,6-8,10-11,23H,2-5H2,(H3,19,20,21,22).
What are the key properties of 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol?
4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol has a molecular weight of 336.34 g/mol, XLogP of 2.84, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-amino-5-(2,4-difluorophenoxy)pyrimidin-4-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 22380404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).