C15H17F3N2O4 — CID 22380580
4-piperidin-4-yl-1,4-benzoxazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 22380580) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-piperidin-4-yl-1,4-benzoxazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-piperidin-4-yl-1,4-benzoxazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22380580 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-piperidin-4-yl-1,4-benzoxazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1COc2ccccc2N1C1CCNCC1 |
| InChI | InChI=1S/C13H16N2O2.C2HF3O2/c16-13-9-17-12-4-2-1-3-11(12)15(13)10-5-7-14-8-6-10;3-2(4,5)1(6)7/h1-4,10,14H,5-9H2;(H,6,7) |
| InChIKey | MKZUUQKMJLNJJQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |