About 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole
4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole (PubChem CID 22380993) has the molecular formula C8H9Cl2F3N2
and a molecular weight of 261.07 g/mol. Its IUPAC name is 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole |
| PubChem CID | 22380993 |
| Molecular Formula | C8H9Cl2F3N2 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1c(C(Cl)CCl)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H9Cl2F3N2/c1-4-6(5(10)3-9)7(8(11,12)13)14-15(4)2/h5H,3H2,1-2H3 |
| InChIKey | RHANZJVIGXAJDO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The IUPAC name of 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole (CID 22380993) is 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole.
What is the SMILES notation for 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The canonical SMILES for 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole is Cc1c(C(Cl)CCl)c(C(F)(F)F)nn1C.
What is the InChIKey of 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The InChIKey is RHANZJVIGXAJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2F3N2/c1-4-6(5(10)3-9)7(8(11,12)13)14-15(4)2/h5H,3H2,1-2H3.
What are the key properties of 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole has a molecular weight of 261.07 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dichloroethyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole is sourced from PubChem (CID 22380993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).