About dibenzylidenepalladium
dibenzylidenepalladium (PubChem CID 22380997) has the molecular formula C14H12Pd
and a molecular weight of 286.67 g/mol. Its IUPAC name is dibenzylidenepalladium.
Molecular Properties
| Compound Name | dibenzylidenepalladium |
| PubChem CID | 22380997 |
| Molecular Formula | C14H12Pd |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | dibenzylidenepalladium |
| SMILES | C(=[Pd]=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C7H6.Pd/c2*1-7-5-3-2-4-6-7;/h2*1-6H; |
| InChIKey | MLWTXFLMRFJZCA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibenzylidenepalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylidenepalladium?
The IUPAC name of dibenzylidenepalladium (CID 22380997) is dibenzylidenepalladium.
What is the SMILES notation for dibenzylidenepalladium?
The canonical SMILES for dibenzylidenepalladium is C(=[Pd]=Cc1ccccc1)c1ccccc1.
What is the InChIKey of dibenzylidenepalladium?
The InChIKey is MLWTXFLMRFJZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6.Pd/c2*1-7-5-3-2-4-6-7;/h2*1-6H;.
What are the key properties of dibenzylidenepalladium?
dibenzylidenepalladium has a molecular weight of 286.67 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylidenepalladium is sourced from PubChem (CID 22380997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).