About 4-(butylamino)butylurea
4-(butylamino)butylurea (PubChem CID 22381160) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-(butylamino)butylurea.
Molecular Properties
| Compound Name | 4-(butylamino)butylurea |
| PubChem CID | 22381160 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 4-(butylamino)butylurea |
| SMILES | CCCCNCCCCNC(N)=O |
| InChI | InChI=1S/C9H21N3O/c1-2-3-6-11-7-4-5-8-12-9(10)13/h11H,2-8H2,1H3,(H3,10,12,13) |
| InChIKey | NVTKCMMUHXBMEW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butylamino)butylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butylamino)butylurea?
The IUPAC name of 4-(butylamino)butylurea (CID 22381160) is 4-(butylamino)butylurea.
What is the SMILES notation for 4-(butylamino)butylurea?
The canonical SMILES for 4-(butylamino)butylurea is CCCCNCCCCNC(N)=O.
What is the InChIKey of 4-(butylamino)butylurea?
The InChIKey is NVTKCMMUHXBMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-2-3-6-11-7-4-5-8-12-9(10)13/h11H,2-8H2,1H3,(H3,10,12,13).
What are the key properties of 4-(butylamino)butylurea?
4-(butylamino)butylurea has a molecular weight of 187.29 g/mol, XLogP of 0.82, 8 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butylamino)butylurea is sourced from PubChem (CID 22381160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).