About 2-bromo-9,9-dibutylfluorene
2-bromo-9,9-dibutylfluorene (PubChem CID 22381647) has the molecular formula C21H25Br
and a molecular weight of 357.34 g/mol. Its IUPAC name is 2-bromo-9,9-dibutylfluorene.
Molecular Properties
| Compound Name | 2-bromo-9,9-dibutylfluorene |
| PubChem CID | 22381647 |
| Molecular Formula | C21H25Br |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-bromo-9,9-dibutylfluorene |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H25Br/c1-3-5-13-21(14-6-4-2)19-10-8-7-9-17(19)18-12-11-16(22)15-20(18)21/h7-12,15H,3-6,13-14H2,1-2H3 |
| InChIKey | AVCNDQUBVOMMSL-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-9,9-dibutylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9,9-dibutylfluorene?
The IUPAC name of 2-bromo-9,9-dibutylfluorene (CID 22381647) is 2-bromo-9,9-dibutylfluorene.
What is the SMILES notation for 2-bromo-9,9-dibutylfluorene?
The canonical SMILES for 2-bromo-9,9-dibutylfluorene is CCCCC1(CCCC)c2ccccc2-c2ccc(Br)cc21.
What is the InChIKey of 2-bromo-9,9-dibutylfluorene?
The InChIKey is AVCNDQUBVOMMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Br/c1-3-5-13-21(14-6-4-2)19-10-8-7-9-17(19)18-12-11-16(22)15-20(18)21/h7-12,15H,3-6,13-14H2,1-2H3.
What are the key properties of 2-bromo-9,9-dibutylfluorene?
2-bromo-9,9-dibutylfluorene has a molecular weight of 357.34 g/mol, XLogP of 7.10, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9,9-dibutylfluorene is sourced from PubChem (CID 22381647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).