About 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride
7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride (PubChem CID 22382) has the molecular formula C13H13ClN2O
and a molecular weight of 248.71 g/mol. Its IUPAC name is 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride.
Molecular Properties
| Compound Name | 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride |
| PubChem CID | 22382 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride |
| SMILES | COc1ccc2c(c1)[NH2+]c1c-2ccnc1C.[Cl-] |
| InChI | InChI=1S/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| InChIKey | VNPLYCKZIUTKJM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 38.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride?
The IUPAC name of 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride (CID 22382) is 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride.
What is the SMILES notation for 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride?
The canonical SMILES for 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride is COc1ccc2c(c1)[NH2+]c1c-2ccnc1C.[Cl-].
What is the InChIKey of 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride?
The InChIKey is VNPLYCKZIUTKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H.
What are the key properties of 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride?
7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride has a molecular weight of 248.71 g/mol, XLogP of -1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-9-ium chloride is sourced from PubChem (CID 22382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).