About (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine
(2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine (PubChem CID 22382334) has the molecular formula C24H30BiN
and a molecular weight of 541.49 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine.
Molecular Properties
| Compound Name | (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine |
| PubChem CID | 22382334 |
| Molecular Formula | C24H30BiN |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine |
| SMILES | CCNCC.Cc1ccc([Bi](c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C8H9.2C6H5.C4H11N.Bi/c1-7-4-3-5-8(2)6-7;2*1-2-4-6-5-3-1;1-3-5-4-2;/h3-4,6H,1-2H3;2*1-5H;5H,3-4H2,1-2H3; |
| InChIKey | KPRSXVSWGZREMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine?
The IUPAC name of (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine (CID 22382334) is (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine.
What is the SMILES notation for (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine?
The canonical SMILES for (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine is CCNCC.Cc1ccc([Bi](c2ccccc2)c2ccccc2)c(C)c1.
What is the InChIKey of (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine?
The InChIKey is KPRSXVSWGZREMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9.2C6H5.C4H11N.Bi/c1-7-4-3-5-8(2)6-7;2*1-2-4-6-5-3-1;1-3-5-4-2;/h3-4,6H,1-2H3;2*1-5H;5H,3-4H2,1-2H3;.
What are the key properties of (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine?
(2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine has a molecular weight of 541.49 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylphenyl)-diphenylbismuthane;N-ethylethanamine is sourced from PubChem (CID 22382334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).