About triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc
triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc (PubChem CID 22386001) has the molecular formula C8H19F3O2SiZn
and a molecular weight of 297.71 g/mol. Its IUPAC name is triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc.
Molecular Properties
| Compound Name | triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc |
| PubChem CID | 22386001 |
| Molecular Formula | C8H19F3O2SiZn |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc |
| SMILES | CC[Si](O)(CC)CC.OCC(F)(F)F.[Zn] |
| InChI | InChI=1S/C6H16OSi.C2H3F3O.Zn/c1-4-8(7,5-2)6-3;3-2(4,5)1-6;/h7H,4-6H2,1-3H3;6H,1H2; |
| InChIKey | QMADTUCFXIHFOW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc?
The IUPAC name of triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc (CID 22386001) is triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc.
What is the SMILES notation for triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc?
The canonical SMILES for triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc is CC[Si](O)(CC)CC.OCC(F)(F)F.[Zn].
What is the InChIKey of triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc?
The InChIKey is QMADTUCFXIHFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16OSi.C2H3F3O.Zn/c1-4-8(7,5-2)6-3;3-2(4,5)1-6;/h7H,4-6H2,1-3H3;6H,1H2;.
What are the key properties of triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc?
triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc has a molecular weight of 297.71 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(hydroxy)silane;2,2,2-trifluoroethanol;zinc is sourced from PubChem (CID 22386001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).