About 2-bromoprop-2-enyl hydrogen carbonate
2-bromoprop-2-enyl hydrogen carbonate (PubChem CID 22386375) has the molecular formula C4H5BrO3
and a molecular weight of 180.98 g/mol. Its IUPAC name is 2-bromoprop-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-bromoprop-2-enyl hydrogen carbonate |
| PubChem CID | 22386375 |
| Molecular Formula | C4H5BrO3 |
| Molecular Weight | 180.98 g/mol |
| Exact Mass | 179.94 |
| IUPAC Name | 2-bromoprop-2-enyl hydrogen carbonate |
| SMILES | C=C(Br)COC(=O)O |
| InChI | InChI=1S/C4H5BrO3/c1-3(5)2-8-4(6)7/h1-2H2,(H,6,7) |
| InChIKey | ZGTARZSAYMEZQI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.98 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromoprop-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoprop-2-enyl hydrogen carbonate?
The IUPAC name of 2-bromoprop-2-enyl hydrogen carbonate (CID 22386375) is 2-bromoprop-2-enyl hydrogen carbonate.
What is the SMILES notation for 2-bromoprop-2-enyl hydrogen carbonate?
The canonical SMILES for 2-bromoprop-2-enyl hydrogen carbonate is C=C(Br)COC(=O)O.
What is the InChIKey of 2-bromoprop-2-enyl hydrogen carbonate?
The InChIKey is ZGTARZSAYMEZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrO3/c1-3(5)2-8-4(6)7/h1-2H2,(H,6,7).
What are the key properties of 2-bromoprop-2-enyl hydrogen carbonate?
2-bromoprop-2-enyl hydrogen carbonate has a molecular weight of 180.98 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoprop-2-enyl hydrogen carbonate is sourced from PubChem (CID 22386375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).