About 1-chlorophthalazine;hydrochloride
1-chlorophthalazine;hydrochloride (PubChem CID 22386464) has the molecular formula C8H6Cl2N2
and a molecular weight of 201.06 g/mol. Its IUPAC name is 1-chlorophthalazine;hydrochloride.
Molecular Properties
| Compound Name | 1-chlorophthalazine;hydrochloride |
| PubChem CID | 22386464 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 1-chlorophthalazine;hydrochloride |
| SMILES | Cl.Clc1nncc2ccccc12 |
| InChI | InChI=1S/C8H5ClN2.ClH/c9-8-7-4-2-1-3-6(7)5-10-11-8;/h1-5H;1H |
| InChIKey | VWXKUBPEUUXLPV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chlorophthalazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorophthalazine;hydrochloride?
The IUPAC name of 1-chlorophthalazine;hydrochloride (CID 22386464) is 1-chlorophthalazine;hydrochloride.
What is the SMILES notation for 1-chlorophthalazine;hydrochloride?
The canonical SMILES for 1-chlorophthalazine;hydrochloride is Cl.Clc1nncc2ccccc12.
What is the InChIKey of 1-chlorophthalazine;hydrochloride?
The InChIKey is VWXKUBPEUUXLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2.ClH/c9-8-7-4-2-1-3-6(7)5-10-11-8;/h1-5H;1H.
What are the key properties of 1-chlorophthalazine;hydrochloride?
1-chlorophthalazine;hydrochloride has a molecular weight of 201.06 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorophthalazine;hydrochloride is sourced from PubChem (CID 22386464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).