About 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine
7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine (PubChem CID 22386542) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine |
| PubChem CID | 22386542 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine |
| SMILES | CCOc1ccc(-c2cc3nccn3c(SCC)n2)cc1OCC |
| InChI | InChI=1S/C18H21N3O2S/c1-4-22-15-8-7-13(11-16(15)23-5-2)14-12-17-19-9-10-21(17)18(20-14)24-6-3/h7-12H,4-6H2,1-3H3 |
| InChIKey | UNDNCNYSKUUZAS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The IUPAC name of 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine (CID 22386542) is 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The canonical SMILES for 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine is CCOc1ccc(-c2cc3nccn3c(SCC)n2)cc1OCC.
What is the InChIKey of 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The InChIKey is UNDNCNYSKUUZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S/c1-4-22-15-8-7-13(11-16(15)23-5-2)14-12-17-19-9-10-21(17)18(20-14)24-6-3/h7-12H,4-6H2,1-3H3.
What are the key properties of 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine has a molecular weight of 343.45 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-diethoxyphenyl)-5-ethylsulfanylimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 22386542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).