C23H23F4NO2 — CID 22387588
4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol (PubChem CID 22387588) has the molecular formula C23H23F4NO2 and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol.
| Compound Name | 4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol |
|---|---|
| PubChem CID | 22387588 |
| Molecular Formula | C23H23F4NO2 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol |
| SMILES | Cc1ccc(CCc2cccc(OC(F)(F)C(F)F)c2)n1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C23H23F4NO2/c1-16-5-9-19(28(16)14-13-17-7-11-20(29)12-8-17)10-6-18-3-2-4-21(15-18)30-23(26,27)22(24)25/h2-5,7-9,11-12,15,22,29H,6,10,13-14H2,1H3 |
| InChIKey | IAEKHQUPUQNOCG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|