C31H41BrN2O2 — CID 22387686
1-[2-(4-bromophenyl)ethyl]-N-decyl-5-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 22387686) has the molecular formula C31H41BrN2O2 and a molecular weight of 553.59 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-N-decyl-5-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-N-decyl-5-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 22387686 |
| Molecular Formula | C31H41BrN2O2 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-N-decyl-5-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCCCCCCCNC(=O)c1cc(-c2ccc(OC)cc2)n(CCc2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C31H41BrN2O2/c1-4-5-6-7-8-9-10-11-21-33-31(35)29-23-30(26-14-18-28(36-3)19-15-26)34(24(29)2)22-20-25-12-16-27(32)17-13-25/h12-19,23H,4-11,20-22H2,1-3H3,(H,33,35) |
| InChIKey | ODAIHNKNVUDGGY-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|