About 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride
3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride (PubChem CID 22387751) has the molecular formula C17H15Cl3N2O2
and a molecular weight of 385.68 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride |
| PubChem CID | 22387751 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride |
| SMILES | CC1=Nc2ccc(C(=O)O)cc2CN1Cc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C17H14Cl2N2O2.ClH/c1-10-20-16-5-3-11(17(22)23)6-13(16)9-21(10)8-12-2-4-14(18)7-15(12)19;/h2-7H,8-9H2,1H3,(H,22,23);1H |
| InChIKey | OWRUXPQFDSKOAV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride?
The IUPAC name of 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride (CID 22387751) is 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride.
What is the SMILES notation for 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride?
The canonical SMILES for 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride is CC1=Nc2ccc(C(=O)O)cc2CN1Cc1ccc(Cl)cc1Cl.Cl.
What is the InChIKey of 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride?
The InChIKey is OWRUXPQFDSKOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2O2.ClH/c1-10-20-16-5-3-11(17(22)23)6-13(16)9-21(10)8-12-2-4-14(18)7-15(12)19;/h2-7H,8-9H2,1H3,(H,22,23);1H.
What are the key properties of 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride?
3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride has a molecular weight of 385.68 g/mol, XLogP of 5.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorophenyl)methyl]-2-methyl-4H-quinazoline-6-carboxylic acid;hydrochloride is sourced from PubChem (CID 22387751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).