C23H17ClO2S — CID 22387878
3-[(2-chloro-4-phenylphenyl)methyl]-2-methyl-1-benzothiophene-5-carboxylic acid (PubChem CID 22387878) has the molecular formula C23H17ClO2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 3-[(2-chloro-4-phenylphenyl)methyl]-2-methyl-1-benzothiophene-5-carboxylic acid.
| Compound Name | 3-[(2-chloro-4-phenylphenyl)methyl]-2-methyl-1-benzothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 22387878 |
| Molecular Formula | C23H17ClO2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[(2-chloro-4-phenylphenyl)methyl]-2-methyl-1-benzothiophene-5-carboxylic acid |
| SMILES | Cc1sc2ccc(C(=O)O)cc2c1Cc1ccc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H17ClO2S/c1-14-19(20-12-18(23(25)26)9-10-22(20)27-14)11-17-8-7-16(13-21(17)24)15-5-3-2-4-6-15/h2-10,12-13H,11H2,1H3,(H,25,26) |
| InChIKey | HIMUNEOUDACLDI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |