C19H20Cl2N2O3 — CID 22387909
ethyl 4-acetamido-3-[[(2,4-dichlorophenyl)methylamino]methyl]benzoate (PubChem CID 22387909) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is ethyl 4-acetamido-3-[[(2,4-dichlorophenyl)methylamino]methyl]benzoate.
| Compound Name | ethyl 4-acetamido-3-[[(2,4-dichlorophenyl)methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 22387909 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 4-acetamido-3-[[(2,4-dichlorophenyl)methylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(C)=O)c(CNCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-3-26-19(25)13-5-7-18(23-12(2)24)15(8-13)11-22-10-14-4-6-16(20)9-17(14)21/h4-9,22H,3,10-11H2,1-2H3,(H,23,24) |
| InChIKey | LMMKPZMXPZNVLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |