C24H20ClN5O5S — CID 22388336
3-[(2-chloro-4-nitrophenyl)methyl]-N-(4-ethenylphenyl)sulfonyl-2,7-dimethylimidazo[4,5-b]pyridine-5-carboxamide (PubChem CID 22388336) has the molecular formula C24H20ClN5O5S and a molecular weight of 525.97 g/mol. Its IUPAC name is 3-[(2-chloro-4-nitrophenyl)methyl]-N-(4-ethenylphenyl)sulfonyl-2,7-dimethylimidazo[4,5-b]pyridine-5-carboxamide.
| Compound Name | 3-[(2-chloro-4-nitrophenyl)methyl]-N-(4-ethenylphenyl)sulfonyl-2,7-dimethylimidazo[4,5-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 22388336 |
| Molecular Formula | C24H20ClN5O5S |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 3-[(2-chloro-4-nitrophenyl)methyl]-N-(4-ethenylphenyl)sulfonyl-2,7-dimethylimidazo[4,5-b]pyridine-5-carboxamide |
| SMILES | C=Cc1ccc(S(=O)(=O)NC(=O)c2cc(C)c3nc(C)n(Cc4ccc([N+](=O)[O-])cc4Cl)c3n2)cc1 |
| InChI | InChI=1S/C24H20ClN5O5S/c1-4-16-5-9-19(10-6-16)36(34,35)28-24(31)21-11-14(2)22-23(27-21)29(15(3)26-22)13-17-7-8-18(30(32)33)12-20(17)25/h4-12H,1,13H2,2-3H3,(H,28,31) |
| InChIKey | OJRHIFSWTQMDNO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|