2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid

C9H8N2O2 — CID 22388435

IUPAC2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid
SMILESCc1cc2cc(C(=O)O)ccn2n1
InChIInChI=1S/C9H8N2O2/c1-6-4-8-5-7(9(12)13)2-3-11(8)10-6/h2-5H,1H3,(H,12,13)
InChIKeyBWMFUCOUGNBIMQ-UHFFFAOYSA-N
MW176.17 g/mol
LogP1.34
Rot. Bonds1

About 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid

2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid (PubChem CID 22388435) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid.

Molecular Properties

Compound Name2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid
PubChem CID22388435
Molecular FormulaC9H8N2O2
Molecular Weight176.17 g/mol
Exact Mass176.06
IUPAC Name2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid
SMILESCc1cc2cc(C(=O)O)ccn2n1
InChIInChI=1S/C9H8N2O2/c1-6-4-8-5-7(9(12)13)2-3-11(8)10-6/h2-5H,1H3,(H,12,13)
InChIKeyBWMFUCOUGNBIMQ-UHFFFAOYSA-N
XLogP1.34
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid?
The IUPAC name of 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid (CID 22388435) is 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid.
What is the SMILES notation for 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid?
The canonical SMILES for 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid is Cc1cc2cc(C(=O)O)ccn2n1.
What is the InChIKey of 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid?
The InChIKey is BWMFUCOUGNBIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-6-4-8-5-7(9(12)13)2-3-11(8)10-6/h2-5H,1H3,(H,12,13).
What are the key properties of 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid?
2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrazolo[1,5-a]pyridine-5-carboxylic acid is sourced from PubChem (CID 22388435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).