C17H15F2N3O2 — CID 22389128
N-(1-azabicyclo[2.2.1]heptan-3-yl)-3-(3,3-difluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide (PubChem CID 22389128) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.1]heptan-3-yl)-3-(3,3-difluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.1]heptan-3-yl)-3-(3,3-difluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 22389128 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(1-azabicyclo[2.2.1]heptan-3-yl)-3-(3,3-difluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(NC1CN2CCC1C2)c1cc2c(C#CC(F)F)coc2cn1 |
| InChI | InChI=1S/C17H15F2N3O2/c18-16(19)2-1-11-9-24-15-6-20-13(5-12(11)15)17(23)21-14-8-22-4-3-10(14)7-22/h5-6,9-10,14,16H,3-4,7-8H2,(H,21,23) |
| InChIKey | KIBYKWZFTHUNMZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|