About 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium
1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 22389812) has the molecular formula C21H18F2O5S2
and a molecular weight of 452.50 g/mol. Its IUPAC name is 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium |
| PubChem CID | 22389812 |
| Molecular Formula | C21H18F2O5S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | COC(=O)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3H4F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10-2(6)3(4,5)11(7,8)9/h1-15H;1H3,(H,7,8,9)/q+1;/p-1 |
| InChIKey | JESLZAVBCIOAPN-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The IUPAC name of 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium (CID 22389812) is 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium.
What is the SMILES notation for 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The canonical SMILES for 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium is COC(=O)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The InChIKey is JESLZAVBCIOAPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C3H4F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10-2(6)3(4,5)11(7,8)9/h1-15H;1H3,(H,7,8,9)/q+1;/p-1.
What are the key properties of 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium has a molecular weight of 452.50 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 22389812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).