C28H25F3O5S2 — CID 22389865
bis(4-methoxyphenyl)-(4-methylphenyl)sulfanium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 22389865) has the molecular formula C28H25F3O5S2 and a molecular weight of 562.63 g/mol. Its IUPAC name is bis(4-methoxyphenyl)-(4-methylphenyl)sulfanium;2-(trifluoromethyl)benzenesulfonate.
| Compound Name | bis(4-methoxyphenyl)-(4-methylphenyl)sulfanium;2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22389865 |
| Molecular Formula | C28H25F3O5S2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | bis(4-methoxyphenyl)-(4-methylphenyl)sulfanium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc([S+](c2ccc(C)cc2)c2ccc(OC)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21O2S.C7H5F3O3S/c1-16-4-10-19(11-5-16)24(20-12-6-17(22-2)7-13-20)21-14-8-18(23-3)9-15-21;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-15H,1-3H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | UULUDOHJAMRORD-UHFFFAOYSA-M |
| XLogP | 6.72 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|