About 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium
2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium (PubChem CID 22389901) has the molecular formula C28H25F3O6S2
and a molecular weight of 578.63 g/mol. Its IUPAC name is 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium |
| PubChem CID | 22389901 |
| Molecular Formula | C28H25F3O6S2 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)c2ccc(OC)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21O3S.C7H5F3O3S/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-15H,1-3H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | XDJIPVJMROYCCZ-UHFFFAOYSA-M |
| XLogP | 6.42 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium?
The IUPAC name of 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium (CID 22389901) is 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium.
What is the SMILES notation for 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium?
The canonical SMILES for 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium is COc1ccc([S+](c2ccc(OC)cc2)c2ccc(OC)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F.
What is the InChIKey of 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium?
The InChIKey is XDJIPVJMROYCCZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21O3S.C7H5F3O3S/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-15H,1-3H3;1-4H,(H,11,12,13)/q+1;/p-1.
What are the key properties of 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium?
2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium has a molecular weight of 578.63 g/mol, XLogP of 6.42, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)benzenesulfonate;tris(4-methoxyphenyl)sulfanium is sourced from PubChem (CID 22389901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).