C28H14F17IO3S — CID 22389909
dinaphthalen-1-yliodanium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 22389909) has the molecular formula C28H14F17IO3S and a molecular weight of 880.35 g/mol. Its IUPAC name is dinaphthalen-1-yliodanium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | dinaphthalen-1-yliodanium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 22389909 |
| Molecular Formula | C28H14F17IO3S |
| Molecular Weight | 880.35 g/mol |
| Exact Mass | 879.94 |
| IUPAC Name | dinaphthalen-1-yliodanium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc2c([I+]c3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H14I.C8HF17O3S/c1-3-11-17-15(7-1)9-5-13-19(17)21-20-14-6-10-16-8-2-4-12-18(16)20;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h1-14H;(H,26,27,28)/q+1;/p-1 |
| InChIKey | HWJRTSXOFZLPEE-UHFFFAOYSA-M |
| XLogP | 6.62 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.35 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|