About bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate
bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 22389926) has the molecular formula C21H12F9IO3S
and a molecular weight of 642.28 g/mol. Its IUPAC name is bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 22389926 |
| Molecular Formula | C21H12F9IO3S |
| Molecular Weight | 642.28 g/mol |
| Exact Mass | 641.94 |
| IUPAC Name | bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | FC(F)(F)c1ccc([I+]c2ccc(C(F)(F)F)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H8F6I.C7H5F3O3S/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-8H;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | NYDCHQBRXGAEPO-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 642.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate?
The IUPAC name of bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate (CID 22389926) is bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate is FC(F)(F)c1ccc([I+]c2ccc(C(F)(F)F)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F.
What is the InChIKey of bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate?
The InChIKey is NYDCHQBRXGAEPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8F6I.C7H5F3O3S/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-8H;1-4H,(H,11,12,13)/q+1;/p-1.
What are the key properties of bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate?
bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate has a molecular weight of 642.28 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(trifluoromethyl)phenyl]iodanium;2-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 22389926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).