C10H9F5O2Si — CID 22389966
ethenyl-dimethoxy-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 22389966) has the molecular formula C10H9F5O2Si and a molecular weight of 284.26 g/mol. Its IUPAC name is ethenyl-dimethoxy-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | ethenyl-dimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 22389966 |
| Molecular Formula | C10H9F5O2Si |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | ethenyl-dimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C=C[Si](OC)(OC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5O2Si/c1-4-18(16-2,17-3)10-8(14)6(12)5(11)7(13)9(10)15/h4H,1H2,2-3H3 |
| InChIKey | HQCCSXVFVCPBBR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|