About (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
(2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 22389984) has the molecular formula C23H34O6
and a molecular weight of 406.52 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| PubChem CID | 22389984 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC.C=CC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H20O2.C5H8O2.C4H6O2/c1-3-13(15)16-14(2)11-5-9-4-10(7-11)8-12(14)6-9;1-4(2)5(6)7-3;1-3(2)4(5)6/h3,9-12H,1,4-8H2,2H3;1H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | HBFUSLPMHGVYRH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (CID 22389984) is (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=C(C)C(=O)OC.C=CC(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is HBFUSLPMHGVYRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2.C5H8O2.C4H6O2/c1-3-13(15)16-14(2)11-5-9-4-10(7-11)8-12(14)6-9;1-4(2)5(6)7-3;1-3(2)4(5)6/h3,9-12H,1,4-8H2,2H3;1H2,2-3H3;1H2,2H3,(H,5,6).
What are the key properties of (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
(2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 406.52 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) prop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 22389984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).