C11H10F6N2O4 — CID 22390021
3-cyclopropyl-2-[2,5-dioxo-4,4-bis(trifluoromethyl)imidazolidin-1-yl]propanoic acid (PubChem CID 22390021) has the molecular formula C11H10F6N2O4 and a molecular weight of 348.20 g/mol. Its IUPAC name is 3-cyclopropyl-2-[2,5-dioxo-4,4-bis(trifluoromethyl)imidazolidin-1-yl]propanoic acid.
| Compound Name | 3-cyclopropyl-2-[2,5-dioxo-4,4-bis(trifluoromethyl)imidazolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 22390021 |
| Molecular Formula | C11H10F6N2O4 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-cyclopropyl-2-[2,5-dioxo-4,4-bis(trifluoromethyl)imidazolidin-1-yl]propanoic acid |
| SMILES | O=C(O)C(CC1CC1)N1C(=O)NC(C(F)(F)F)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H10F6N2O4/c12-10(13,14)9(11(15,16)17)7(22)19(8(23)18-9)5(6(20)21)3-4-1-2-4/h4-5H,1-3H2,(H,18,23)(H,20,21) |
| InChIKey | SXQKCZMHZUABRF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|