C26H28FN7O — CID 22390490
5-[3-(dimethylamino)propoxymethyl]-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 22390490) has the molecular formula C26H28FN7O and a molecular weight of 473.56 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propoxymethyl]-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-[3-(dimethylamino)propoxymethyl]-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 22390490 |
| Molecular Formula | C26H28FN7O |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 5-[3-(dimethylamino)propoxymethyl]-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CN(C)CCCOCc1ccn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C26H28FN7O/c1-32(2)10-4-12-35-17-20-9-11-33-25(20)26(28-18-30-33)31-23-7-8-24-21(14-23)15-29-34(24)16-19-5-3-6-22(27)13-19/h3,5-9,11,13-15,18H,4,10,12,16-17H2,1-2H3,(H,28,30,31) |
| InChIKey | NKAFAOZJYRUFSQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|