About 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine
2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine (PubChem CID 22390713) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine |
| PubChem CID | 22390713 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine |
| SMILES | NCCc1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C10H12N4/c11-6-5-9-1-3-10(4-2-9)14-7-12-13-8-14/h1-4,7-8H,5-6,11H2 |
| InChIKey | RFVLUEHMLQTRRC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine?
The IUPAC name of 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine (CID 22390713) is 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine.
What is the SMILES notation for 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine?
The canonical SMILES for 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine is NCCc1ccc(-n2cnnc2)cc1.
What is the InChIKey of 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine?
The InChIKey is RFVLUEHMLQTRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c11-6-5-9-1-3-10(4-2-9)14-7-12-13-8-14/h1-4,7-8H,5-6,11H2.
What are the key properties of 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine?
2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine has a molecular weight of 188.23 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2,4-triazol-4-yl)phenyl]ethanamine is sourced from PubChem (CID 22390713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).