About indol-4-one
indol-4-one (PubChem CID 22392037) has the molecular formula C8H5NO
and a molecular weight of 131.13 g/mol. Its IUPAC name is indol-4-one.
Molecular Properties
| Compound Name | indol-4-one |
| PubChem CID | 22392037 |
| Molecular Formula | C8H5NO |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | indol-4-one |
| SMILES | O=C1C=CC=C2N=CC=C12 |
| InChI | InChI=1S/C8H5NO/c10-8-3-1-2-7-6(8)4-5-9-7/h1-5H |
| InChIKey | KCKIKSJECTZLJA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-4-one?
The IUPAC name of indol-4-one (CID 22392037) is indol-4-one.
What is the SMILES notation for indol-4-one?
The canonical SMILES for indol-4-one is O=C1C=CC=C2N=CC=C12.
What is the InChIKey of indol-4-one?
The InChIKey is KCKIKSJECTZLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO/c10-8-3-1-2-7-6(8)4-5-9-7/h1-5H.
What are the key properties of indol-4-one?
indol-4-one has a molecular weight of 131.13 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indol-4-one is sourced from PubChem (CID 22392037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).