C10H5F2N3O — CID 22392643
2,5-difluoro-4-(5-oxo-4H-pyrazol-1-yl)benzonitrile (PubChem CID 22392643) has the molecular formula C10H5F2N3O and a molecular weight of 221.17 g/mol. Its IUPAC name is 2,5-difluoro-4-(5-oxo-4H-pyrazol-1-yl)benzonitrile.
| Compound Name | 2,5-difluoro-4-(5-oxo-4H-pyrazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 22392643 |
| Molecular Formula | C10H5F2N3O |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2,5-difluoro-4-(5-oxo-4H-pyrazol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(F)c(N2N=CCC2=O)cc1F |
| InChI | InChI=1S/C10H5F2N3O/c11-7-4-9(8(12)3-6(7)5-13)15-10(16)1-2-14-15/h2-4H,1H2 |
| InChIKey | YVUOXDKKWZKKHA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |